CAS 2059937-38-9 is the registry number for N-{1-((4-chlorophenyl)methyl)-1-cyanoethyl}acetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
N-[1-(4-chlorophenyl)-2-cyanopropan-2-yl]acetamide (CAS 2059937-38-9) is a chemical compound with the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. IUPAC name: N-[1-(4-chlorophenyl)-2-cyanopropan-2-yl]acetamide. InChIKey: PGPINKHXPDJKMK-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O |
|---|---|
| Molecular weight | 236.70 g/mol |
| IUPAC name | N-[1-(4-chlorophenyl)-2-cyanopropan-2-yl]acetamide |
| InChIKey | PGPINKHXPDJKMK-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(C)(CC1=CC=C(C=C1)Cl)C#N |
Computed by PubChem (NCBI)