CAS 2059999-76-5 appears in our catalog under these names: tert-Butyl 3-methyl-(1,2,4)triazolo(4,3-a)pyrazine-6-carboxylate, 95%, tert-Butyl 3-methyl-(1,2,4)triazolo(4,3-a)pyrazine-6-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl 3-methyl-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxylate (CAS 2059999-76-5) is a chemical compound with the molecular formula C11H14N4O2 and a molecular weight of 234.25 g/mol. IUPAC name: tert-butyl 3-methyl-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxylate. InChIKey: XGLWLXPLDUXSPA-UHFFFAOYSA-N.
| Molecular formula | C11H14N4O2 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | tert-butyl 3-methyl-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxylate |
| InChIKey | XGLWLXPLDUXSPA-UHFFFAOYSA-N |
| SMILES | CC1=NN=C2N1C=C(N=C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)