Products 2060024-62-4
CAS 2060024-62-4 is the registry number for 2-Chloro-1-(4-hydroxy-2,3-dihydro-1H-isoindol-2-yl)ethan-1-one, 95%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
2-chloro-1-(4-hydroxy-1,3-dihydroisoindol-2-yl)ethanone (CAS 2060024-62-4) is a chemical compound with the molecular formula C10H10ClNO2 and a molecular weight of 211.64 g/mol. IUPAC name: 2-chloro-1-(4-hydroxy-1,3-dihydroisoindol-2-yl)ethanone. InChIKey: RWPZUNVIBSGNPV-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO2 |
|---|---|
| Molecular weight | 211.64 g/mol |
| IUPAC name | 2-chloro-1-(4-hydroxy-1,3-dihydroisoindol-2-yl)ethanone |
| InChIKey | RWPZUNVIBSGNPV-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1C(=O)CCl)C(=CC=C2)O |
Computed by PubChem (NCBI)