Products 2060051-45-6
CAS 2060051-45-6 is the registry number for 4,6-Dichloro-1,3-dimethyl-1H-pyrazolo(3,4-b)pyridine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4,6-dichloro-1,3-dimethylpyrazolo[5,4-b]pyridine (CAS 2060051-45-6) is a chemical compound with the molecular formula C8H7Cl2N3 and a molecular weight of 216.06 g/mol. IUPAC name: 4,6-dichloro-1,3-dimethylpyrazolo[5,4-b]pyridine. InChIKey: CAYCBZPKHZCRTI-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2N3 |
|---|---|
| Molecular weight | 216.06 g/mol |
| IUPAC name | 4,6-dichloro-1,3-dimethylpyrazolo[5,4-b]pyridine |
| InChIKey | CAYCBZPKHZCRTI-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=CC(=N2)Cl)Cl)C |
Computed by PubChem (NCBI)