Products 2061980-31-0
CAS 2061980-31-0 appears in our catalog under these names: Methyl 5-amino-2,3-dihydro-1H-indene-2-carboxylate hydrochloride, 97%, 97%, Methyl 5-amino-2,3-dihydro-1H-indene-2-carboxylate hydrochloride, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg, 50mg.
Methyl 5-amino-2,3-dihydro-1H-indene-2-carboxylate;hydrochloride (CAS 2061980-31-0) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: methyl 5-amino-2,3-dihydro-1H-indene-2-carboxylate;hydrochloride. InChIKey: GELDUIIECPNHTL-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | methyl 5-amino-2,3-dihydro-1H-indene-2-carboxylate;hydrochloride |
| InChIKey | GELDUIIECPNHTL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC2=C(C1)C=C(C=C2)N.Cl |
Computed by PubChem (NCBI)