CAS 2061996-47-0 appears in our catalog under these names: (S)-7-Fluoro-2,3-dihydro-1h-inden-1-amine hydrochloride, 95%, (S)–7–Fluoro–2,3–dihydro–1H–inden–1–amine hydrochloride, (S)-7-Fluoro-2,3-dihydro-1H-inden-1-amine hydrochloride, 97%, 97%, (S)-7-Fluoro-2,3-dihydro-1H-inden-1-amine hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 25mg, 50mg.
(1S)-7-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 2061996-47-0) is a chemical compound with the molecular formula C9H11ClFN and a molecular weight of 187.64 g/mol. IUPAC name: (1S)-7-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: GUYSNVAUQOXGKN-QRPNPIFTSA-N.
| Molecular formula | C9H11ClFN |
|---|---|
| Molecular weight | 187.64 g/mol |
| IUPAC name | (1S)-7-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | GUYSNVAUQOXGKN-QRPNPIFTSA-N |
| SMILES | C1CC2=C([C@H]1N)C(=CC=C2)F.Cl |
Computed by PubChem (NCBI)