CAS 2241594-19-2 is the registry number for 7-Fluoro-2,3-dihydro-1H-inden-1-amine hydrochloride, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
7-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 2241594-19-2) is a chemical compound with the molecular formula C9H11ClFN and a molecular weight of 187.64 g/mol. IUPAC name: 7-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: GUYSNVAUQOXGKN-UHFFFAOYSA-N.
| Molecular formula | C9H11ClFN |
|---|---|
| Molecular weight | 187.64 g/mol |
| IUPAC name | 7-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | GUYSNVAUQOXGKN-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1N)C(=CC=C2)F.Cl |
Computed by PubChem (NCBI)