CAS 2064219-14-1 is the registry number for Avibactam Impurity 56. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,5S)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboxylic acid (CAS 2064219-14-1) is a chemical compound with the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. IUPAC name: (2S,5S)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboxylic acid. InChIKey: UMHGLONVYIYIOU-RYUDHWBXSA-N.
| Molecular formula | C14H16N2O4 |
|---|---|
| Molecular weight | 276.29 g/mol |
| IUPAC name | (2S,5S)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboxylic acid |
| InChIKey | UMHGLONVYIYIOU-RYUDHWBXSA-N |
| SMILES | C1C[C@H](N2C[C@H]1N(C2=O)OCC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)