Products 1952337-86-8

CAS 1952337-86-8 is the registry number for 1-tert-Butyl 5-methyl 1h-pyrrolo[2,3-c]pyridine-1,5-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 5-O-methyl pyrrolo[2,3-c]pyridine-1,5-dicarboxylate (CAS 1952337-86-8) is a chemical compound with the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. IUPAC name: 1-O-tert-butyl 5-O-methyl pyrrolo[2,3-c]pyridine-1,5-dicarboxylate. InChIKey: IPHOOZMLSAPETF-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16N2O4
Molecular weight276.29 g/mol
IUPAC name1-O-tert-butyl 5-O-methyl pyrrolo[2,3-c]pyridine-1,5-dicarboxylate
InChIKeyIPHOOZMLSAPETF-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1C=CC2=CC(=NC=C21)C(=O)OC

Computed by PubChem (NCBI)