CAS 191723-66-7 appears in our catalog under these names: H-Thr-amc, 95%, H-Thr-AMC, H–Thr–AMC. Offered by: Combi-blocks, Creative Peptides, GLPBio, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 50mg, 0,1g, 0,05g, 0,25g, 0,5g.
(2S,3R)-2-amino-3-hydroxy-N-(4-methyl-2-oxochromen-7-yl)butanamide (CAS 191723-66-7) is a chemical compound with the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. IUPAC name: (2S,3R)-2-amino-3-hydroxy-N-(4-methyl-2-oxochromen-7-yl)butanamide. InChIKey: OIZVQDJSQAAKEU-OQPBUACISA-N.
| Molecular formula | C14H16N2O4 |
|---|---|
| Molecular weight | 276.29 g/mol |
| IUPAC name | (2S,3R)-2-amino-3-hydroxy-N-(4-methyl-2-oxochromen-7-yl)butanamide |
| InChIKey | OIZVQDJSQAAKEU-OQPBUACISA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H]([C@@H](C)O)N |
Computed by PubChem (NCBI)