CAS 67010-09-7 appears in our catalog under these names: N-Acetyl-5-methoxy-l-tryptophan, 95%, (S)-2-Acetamido-3-(5-methoxy-1H-indol-3-yl)propanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
(2S)-2-acetamido-3-(5-methoxy-1H-indol-3-yl)propanoic acid (CAS 67010-09-7) is a chemical compound with the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. IUPAC name: (2S)-2-acetamido-3-(5-methoxy-1H-indol-3-yl)propanoic acid. InChIKey: IJODSTPSSWJSBC-ZDUSSCGKSA-N.
| Molecular formula | C14H16N2O4 |
|---|---|
| Molecular weight | 276.29 g/mol |
| IUPAC name | (2S)-2-acetamido-3-(5-methoxy-1H-indol-3-yl)propanoic acid |
| InChIKey | IJODSTPSSWJSBC-ZDUSSCGKSA-N |
| SMILES | CC(=O)N[C@@H](CC1=CNC2=C1C=C(C=C2)OC)C(=O)O |
Computed by PubChem (NCBI)