Products 1031524-51-2
CAS 1031524-51-2 is the registry number for 4-(4,4-Dimethyl-2,5-dioxo-imidazolidin-1-ylmethyl)-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 4-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]benzoate (CAS 1031524-51-2) is a chemical compound with the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. IUPAC name: methyl 4-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]benzoate. InChIKey: RSNSPKNAFGEAGI-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O4 |
|---|---|
| Molecular weight | 276.29 g/mol |
| IUPAC name | methyl 4-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
| InChIKey | RSNSPKNAFGEAGI-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(C(=O)N1)CC2=CC=C(C=C2)C(=O)OC)C |
Computed by PubChem (NCBI)