CAS 20660-73-5 appears in our catalog under these names: 2-(Bromomethyl)-3-nitropyridine, 97%, Pyridine， 2-(bromomethyl)-3-nitro-, 95%, 95%, 2-(BROMOMETHYL)-3-NITROPYRIDINE, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2-(bromomethyl)-3-nitropyridine (CAS 20660-73-5) is a chemical compound with the molecular formula C6H5BrN2O2 and a molecular weight of 217.02 g/mol. IUPAC name: 2-(bromomethyl)-3-nitropyridine. InChIKey: BGXQFAXHRDFUEX-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 2-(bromomethyl)-3-nitropyridine |
| InChIKey | BGXQFAXHRDFUEX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)CBr)[N+](=O)[O-] |
Computed by PubChem (NCBI)