CAS 2068724-48-9 is the registry number for N-(6-CHLORO-3-OXO-2,3-DIHYDROPYRIDAZIN-4-YL)PIVALAMIDE, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
N-(3-chloro-6-oxo-1H-pyridazin-5-yl)-2,2-dimethylpropanamide (CAS 2068724-48-9) is a chemical compound with the molecular formula C9H12ClN3O2 and a molecular weight of 229.66 g/mol. IUPAC name: N-(3-chloro-6-oxo-1H-pyridazin-5-yl)-2,2-dimethylpropanamide. InChIKey: KSZYWDVUGCMBDU-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3O2 |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | N-(3-chloro-6-oxo-1H-pyridazin-5-yl)-2,2-dimethylpropanamide |
| InChIKey | KSZYWDVUGCMBDU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC(=NNC1=O)Cl |
Computed by PubChem (NCBI)