CAS 2074703-59-4 appears in our catalog under these names: (R)-1-(2-FLUORO-5-METHOXYPHENYL)ETHAN-1-AMINE HCL, 98%, (R)-1-(2-Fluoro-5-methoxyphenyl)ethan-1-amine hydrochloride, 95%, 95%, (R)-1-(2-FLUORO-5-METHOXYPHENYL)ETHAN-1-AMINE HCL, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
(1R)-1-(2-fluoro-5-methoxyphenyl)ethanamine;hydrochloride (CAS 2074703-59-4) is a chemical compound with the molecular formula C9H13ClFNO and a molecular weight of 205.66 g/mol. IUPAC name: (1R)-1-(2-fluoro-5-methoxyphenyl)ethanamine;hydrochloride. InChIKey: NCSJECMMTDGRMS-FYZOBXCZSA-N.
| Molecular formula | C9H13ClFNO |
|---|---|
| Molecular weight | 205.66 g/mol |
| IUPAC name | (1R)-1-(2-fluoro-5-methoxyphenyl)ethanamine;hydrochloride |
| InChIKey | NCSJECMMTDGRMS-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=C(C=CC(=C1)OC)F)N.Cl |
Computed by PubChem (NCBI)