Products 2089380-99-2
CAS 2089380-99-2 appears in our catalog under these names: 1-(2-Fluoro-5-methoxyphenyl)ethanamine hydrochloride, 97%, 1-(2-Fluoro-5-methoxyphenyl)ethanamine hydrochloride, 97%, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(2-fluoro-5-methoxyphenyl)ethanamine;hydrochloride (CAS 2089380-99-2) is a chemical compound with the molecular formula C9H13ClFNO and a molecular weight of 205.66 g/mol. IUPAC name: 1-(2-fluoro-5-methoxyphenyl)ethanamine;hydrochloride. InChIKey: NCSJECMMTDGRMS-UHFFFAOYSA-N.
| Molecular formula | C9H13ClFNO |
|---|---|
| Molecular weight | 205.66 g/mol |
| IUPAC name | 1-(2-fluoro-5-methoxyphenyl)ethanamine;hydrochloride |
| InChIKey | NCSJECMMTDGRMS-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=CC(=C1)OC)F)N.Cl |
Computed by PubChem (NCBI)