Products 207569-25-3
CAS 207569-25-3 appears in our catalog under these names: 4-Nitro-DL-phenylalanine Hydrate, >98.0%(HPLC)(T), 4-Nitro-DL-phenylalanine, ≥98%, ≥98%. Offered by: TCI, Chemat. Available pack sizes: 5g, 25g, 1g, 10g, 100g.
2-amino-3-(4-nitrophenyl)propanoic acid;hydrate (CAS 207569-25-3) is a chemical compound with the molecular formula C9H12N2O5 and a molecular weight of 228.20 g/mol. IUPAC name: 2-amino-3-(4-nitrophenyl)propanoic acid;hydrate. InChIKey: OLZDHJRNUIXKLU-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O5 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | 2-amino-3-(4-nitrophenyl)propanoic acid;hydrate |
| InChIKey | OLZDHJRNUIXKLU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(C(=O)O)N)[N+](=O)[O-].O |
Computed by PubChem (NCBI)
Synonyms:
4-Nitro-Dl-Phenylalanine Hydrate, 2-amino-3-(4-nitrophenyl)propanoic acid hydrate, (S)-4-Nitrophenylalanine hydrate, 4-Nitro-DL-phenylalanine xhydrate, 2-amino-3-(4-nitrophenyl)propanoic acid;hydrate, 4-Nitro-D-phenylalanine monohydrate, D-Phe(4-NO2), H-Phe(4-NO2)-OH monohydrate, 4-Nitro-DL-phenylalaninexhydrate, (2S)-2-amino-3-(4-nitrophenyl)propanoic acid,hydrate