CAS 207571-58-2 appears in our catalog under these names: 2-(Nitrooxy)ethyl 3-pyridinecarboxylate, 95%, 95%, Nicorandil Impurity 17. Offered by: Chemat, Chemat Brand. Available pack sizes: 100mg, 250mg, on request.
2-nitrooxyethyl pyridine-3-carboxylate (CAS 207571-58-2) is a chemical compound with the molecular formula C8H8N2O5 and a molecular weight of 212.16 g/mol. IUPAC name: 2-nitrooxyethyl pyridine-3-carboxylate. InChIKey: WGHHXOKCKNOHEG-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O5 |
|---|---|
| Molecular weight | 212.16 g/mol |
| IUPAC name | 2-nitrooxyethyl pyridine-3-carboxylate |
| InChIKey | WGHHXOKCKNOHEG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(=O)OCCO[N+](=O)[O-] |
Computed by PubChem (NCBI)