Products 207792-17-4
CAS 207792-17-4 appears in our catalog under these names: 1，7–Bis(4–hydroxyphenyl)–3–hydroxy–1，3–heptadien–5–one, 1,7-Bis(4-hydroxyphenyl)-3-hydroxy-1,3-heptadien-5-one. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
(4Z,6E)-5-hydroxy-1,7-bis(4-hydroxyphenyl)hepta-4,6-dien-3-one (CAS 207792-17-4) is a chemical compound with the molecular formula C19H18O4 and a molecular weight of 310.3 g/mol. IUPAC name: (4Z,6E)-5-hydroxy-1,7-bis(4-hydroxyphenyl)hepta-4,6-dien-3-one. InChIKey: XLKHKZCPVAHTFN-YLMKKNOUSA-N.
| Molecular formula | C19H18O4 |
|---|---|
| Molecular weight | 310.3 g/mol |
| IUPAC name | (4Z,6E)-5-hydroxy-1,7-bis(4-hydroxyphenyl)hepta-4,6-dien-3-one |
| InChIKey | XLKHKZCPVAHTFN-YLMKKNOUSA-N |
| SMILES | C1=CC(=CC=C1CCC(=O)/C=C(/C=C/C2=CC=C(C=C2)O)\O)O |
Computed by PubChem (NCBI)