CAS 207850-66-6 appears in our catalog under these names: 2,2-Dimethyl-1-(pyridin-3-yl)propan-1-amine hydrochloride, 97%, 2,2-Dimethyl-1-(pyridin-3-yl)propan-1-amine hydrochloride. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 250mg, 100mg, 500mg.
2,2-dimethyl-1-pyridin-3-ylpropan-1-amine;hydrochloride (CAS 207850-66-6) is a chemical compound with the molecular formula C10H17ClN2 and a molecular weight of 200.71 g/mol. IUPAC name: 2,2-dimethyl-1-pyridin-3-ylpropan-1-amine;hydrochloride. InChIKey: FZGBQYBWXRMDSQ-UHFFFAOYSA-N.
| Molecular formula | C10H17ClN2 |
|---|---|
| Molecular weight | 200.71 g/mol |
| IUPAC name | 2,2-dimethyl-1-pyridin-3-ylpropan-1-amine;hydrochloride |
| InChIKey | FZGBQYBWXRMDSQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C1=CN=CC=C1)N.Cl |
Computed by PubChem (NCBI)