Products 2512189-82-9
CAS 2512189-82-9 is the registry number for 2-(Difluoromethyl)-1,4-difluorobenzene, 97%, 97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
2,2-dimethyl-1-pyridin-3-ylpropan-1-amine;hydrochloride (CAS 2512189-82-9) is a chemical compound with the molecular formula C10H17ClN2 and a molecular weight of 200.71 g/mol. IUPAC name: 2,2-dimethyl-1-pyridin-3-ylpropan-1-amine;hydrochloride. InChIKey: FZGBQYBWXRMDSQ-UHFFFAOYSA-N.
| Molecular formula | C10H17ClN2 |
|---|---|
| Molecular weight | 200.71 g/mol |
| IUPAC name | 2,2-dimethyl-1-pyridin-3-ylpropan-1-amine;hydrochloride |
| InChIKey | FZGBQYBWXRMDSQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C1=CN=CC=C1)N.Cl |
Computed by PubChem (NCBI)