Products 20800-00-4
CAS 20800-00-4 appears in our catalog under these names: 4,4'–Azanediyldibenzoic acid, 4,4'-Azanediyldibenzoic acid, 97%, 4,4'-IMINODIBENZOIC ACID, 98%, 4,4'-Azanediyldibenzoic acid, 98%. Offered by: GLPBio, Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 25g.
4-(4-carboxyanilino)benzoic acid (CAS 20800-00-4) is a chemical compound with the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. IUPAC name: 4-(4-carboxyanilino)benzoic acid. InChIKey: JGFIUFCBEWNBDN-UHFFFAOYSA-N.
| Molecular formula | C14H11NO4 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 4-(4-carboxyanilino)benzoic acid |
| InChIKey | JGFIUFCBEWNBDN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)NC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4,4'-Iminodibenzoic acid, 4,4'-Azanediyldibenzoic acid, 4-(4-carboxyanilino)benzoic acid, benzoic acid, 4,4'-iminobis-, 4-[(4-carboxyphenyl)amino]benzoic Acid, Benzoic acid,4,4'-iminobis-, di(p-carboxyphenyl)amine, 4,4'-dicarboxydiphenylamine, 4,4''-Iminodibenzoic acid, 4,4'-Azanediyldibenzoicacid