Products 2086337-18-8
CAS 2086337-18-8 is the registry number for Hypoxanthine-13C5, 98.0%. Offered by: MedChemExpress. Available pack sizes: 500 μg, 100 μg.
1,7-dihydropurin-6-one (CAS 2086337-18-8) is a chemical compound with the molecular formula C5H4N4O and a molecular weight of 141.08 g/mol. IUPAC name: 1,7-dihydropurin-6-one. InChIKey: FDGQSTZJBFJUBT-CVMUNTFWSA-N.
| Molecular formula | C5H4N4O |
|---|---|
| Molecular weight | 141.08 g/mol |
| IUPAC name | 1,7-dihydropurin-6-one |
| InChIKey | FDGQSTZJBFJUBT-CVMUNTFWSA-N |
| SMILES | [13CH]1=N[13C]2=[13C](N1)[13C](=O)N[13CH]=N2 |
Computed by PubChem (NCBI)
Synonyms:
Hypoxanthine-13C5, orb3138311