Products 208660-68-8
CAS 208660-68-8 appears in our catalog under these names: H–β–(7–Methoxycoumarin–4–yl)–Ala–OH, H-beta-(7-Methoxycoumarin-4-yl)-Ala-OH. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 500mg, 250mg.
2-amino-3-(7-methoxy-2-oxochromen-4-yl)propanoic acid (CAS 208660-68-8) is a chemical compound with the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. IUPAC name: 2-amino-3-(7-methoxy-2-oxochromen-4-yl)propanoic acid. InChIKey: IOHUIWNMQPWOAX-UHFFFAOYSA-N.
| Molecular formula | C13H13NO5 |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | 2-amino-3-(7-methoxy-2-oxochromen-4-yl)propanoic acid |
| InChIKey | IOHUIWNMQPWOAX-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=CC(=O)O2)CC(C(=O)O)N |
Computed by PubChem (NCBI)