Products 208663-08-5

CAS 208663-08-5 is the registry number for N-(5-Chloro-2-methylphenyl)maleamic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.

Structural formula: {0} (CAS {1})

(Z)-4-(5-chloro-2-methylanilino)-4-oxobut-2-enoic acid (CAS 208663-08-5) is a chemical compound with the molecular formula C11H10ClNO3 and a molecular weight of 239.65 g/mol. IUPAC name: (Z)-4-(5-chloro-2-methylanilino)-4-oxobut-2-enoic acid. InChIKey: KFLFGXYJSLVOCF-PLNGDYQASA-N.

Identity
Molecular formulaC11H10ClNO3
Molecular weight239.65 g/mol
IUPAC name(Z)-4-(5-chloro-2-methylanilino)-4-oxobut-2-enoic acid
InChIKeyKFLFGXYJSLVOCF-PLNGDYQASA-N
SMILESCC1=C(C=C(C=C1)Cl)NC(=O)/C=C\C(=O)O

Computed by PubChem (NCBI)