CAS 2089277-65-4 is the registry number for Methyl 2-chloro-5H-pyrrolo(3,2-d)pyrimidine-4-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 2-chloro-5H-pyrrolo[3,2-d]pyrimidine-4-carboxylate (CAS 2089277-65-4) is a chemical compound with the molecular formula C8H6ClN3O2 and a molecular weight of 211.60 g/mol. IUPAC name: methyl 2-chloro-5H-pyrrolo[3,2-d]pyrimidine-4-carboxylate. InChIKey: ZAVZICYQWWROAE-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O2 |
|---|---|
| Molecular weight | 211.60 g/mol |
| IUPAC name | methyl 2-chloro-5H-pyrrolo[3,2-d]pyrimidine-4-carboxylate |
| InChIKey | ZAVZICYQWWROAE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=NC2=C1NC=C2)Cl |
Computed by PubChem (NCBI)