Products 2089289-59-6
CAS 2089289-59-6 is the registry number for (6S,9R)-2-Hydroxy-4-(2,6,6-trimethyl-4-oxo-cyclohex-2-enyl)-butyric acid. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg, 10 mg.
(2R)-2-hydroxy-4-[(1S)-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]butanoic acid (CAS 2089289-59-6) is a chemical compound with the molecular formula C13H20O4 and a molecular weight of 240.29 g/mol. IUPAC name: (2R)-2-hydroxy-4-[(1S)-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]butanoic acid. InChIKey: DRGFANANRHKQAN-GHMZBOCLSA-N.
| Molecular formula | C13H20O4 |
|---|---|
| Molecular weight | 240.29 g/mol |
| IUPAC name | (2R)-2-hydroxy-4-[(1S)-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]butanoic acid |
| InChIKey | DRGFANANRHKQAN-GHMZBOCLSA-N |
| SMILES | CC1=CC(=O)CC([C@@H]1CC[C@H](C(=O)O)O)(C)C |
Computed by PubChem (NCBI)