Products 2089292-64-6
CAS 2089292-64-6 appears in our catalog under these names: 2–Amino–3–(thiazol–5–yl)propanoic acid hydrochloride, H-DL-Ala(thiazol-5-yl)-OH HCl, 97%, 2-Amino-3-(thiazol-5-yl)propanoic acid hydrochloride, 97%. Offered by: GLPBio, Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
2-amino-3-(1,3-thiazol-5-yl)propanoic acid;hydrochloride (CAS 2089292-64-6) is a chemical compound with the molecular formula C6H9ClN2O2S and a molecular weight of 208.67 g/mol. IUPAC name: 2-amino-3-(1,3-thiazol-5-yl)propanoic acid;hydrochloride. InChIKey: WPTRJRFKLLPZND-UHFFFAOYSA-N.
| Molecular formula | C6H9ClN2O2S |
|---|---|
| Molecular weight | 208.67 g/mol |
| IUPAC name | 2-amino-3-(1,3-thiazol-5-yl)propanoic acid;hydrochloride |
| InChIKey | WPTRJRFKLLPZND-UHFFFAOYSA-N |
| SMILES | C1=C(SC=N1)CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)