CAS 2089315-05-7 is the registry number for 2,6–Dichloro–3–methyl–4–nitropyridine. Offered by: GLPBio. Available pack sizes: 100mg.
2,6-dichloro-3-methyl-4-nitropyridine (CAS 2089315-05-7) is a chemical compound with the molecular formula C6H4Cl2N2O2 and a molecular weight of 207.01 g/mol. IUPAC name: 2,6-dichloro-3-methyl-4-nitropyridine. InChIKey: HSINFMDETPIEIM-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O2 |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | 2,6-dichloro-3-methyl-4-nitropyridine |
| InChIKey | HSINFMDETPIEIM-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(C=C1[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)