Products 2089333-16-2
CAS 2089333-16-2 is the registry number for 6-Desacetyl-6-bromo-N-Boc Palbociclib-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 50 mg, 10 mg, 25 mg.
2-[3-(trifluoromethyl)phenoxy]acetic acid (CAS 2089333-16-2) is a chemical compound with the molecular formula C9H7F3O3 and a molecular weight of 220.14 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenoxy]acetic acid. InChIKey: KTTDWGZRVMNQNZ-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O3 |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenoxy]acetic acid |
| InChIKey | KTTDWGZRVMNQNZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
2-[3-(trifluoromethyl)phenoxy]acetic acid, 2-(3-(Trifluoromethyl)phenoxy)acetic acid, [3-(trifluoromethyl)phenoxy]acetic acid, (3-Trifluoromethyl-phenoxy)-acetic acid, 3-(trifluoromethyl)phenoxyacetic acid, 6-Desacetyl-6-bromo-N-Boc Palbociclib-d4, (3-Trifluoromethylphenoxy)acetic acid, 2-(3-Trifluoromethylphenoxy)acetic acid, Travoprost Impurity 6, Enamine_004623