CAS 2089671-42-9 is the registry number for (S)-1-Cyclopentyl-2,2,2-trifluoroethan-1-amine hydrochloride, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 5g.
(1S)-1-cyclopentyl-2,2,2-trifluoroethanamine;hydrochloride (CAS 2089671-42-9) is a chemical compound with the molecular formula C7H13ClF3N and a molecular weight of 203.63 g/mol. IUPAC name: (1S)-1-cyclopentyl-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: KUXNOAUBDNRTEA-RGMNGODLSA-N.
| Molecular formula | C7H13ClF3N |
|---|---|
| Molecular weight | 203.63 g/mol |
| IUPAC name | (1S)-1-cyclopentyl-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | KUXNOAUBDNRTEA-RGMNGODLSA-N |
| SMILES | C1CCC(C1)[C@@H](C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)