Products 2089753-92-2
CAS 2089753-92-2 is the registry number for 1-(Cyclopropylmethyl)-5-(trifluoromethyl)-1h-pyrazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
1-(cyclopropylmethyl)-5-(trifluoromethyl)pyrazole-3-carboxylic acid (CAS 2089753-92-2) is a chemical compound with the molecular formula C9H9F3N2O2 and a molecular weight of 234.17 g/mol. IUPAC name: 1-(cyclopropylmethyl)-5-(trifluoromethyl)pyrazole-3-carboxylic acid. InChIKey: PMPHHZFZKXWJRD-UHFFFAOYSA-N.
| Molecular formula | C9H9F3N2O2 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | 1-(cyclopropylmethyl)-5-(trifluoromethyl)pyrazole-3-carboxylic acid |
| InChIKey | PMPHHZFZKXWJRD-UHFFFAOYSA-N |
| SMILES | C1CC1CN2C(=CC(=N2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)