Products 2090819-94-4
CAS 2090819-94-4 is the registry number for Methyl 4-bromo-5-hydroxy-2-methylbenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-bromo-5-hydroxy-2-methylbenzoate (CAS 2090819-94-4) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: methyl 4-bromo-5-hydroxy-2-methylbenzoate. InChIKey: NFHGIEKRZYKTTC-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | methyl 4-bromo-5-hydroxy-2-methylbenzoate |
| InChIKey | NFHGIEKRZYKTTC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)OC)O)Br |
Computed by PubChem (NCBI)