Products 2090953-73-2
CAS 2090953-73-2 is the registry number for 2-fluoro-4-(hydroxymethyl)-6-methoxy-benzonitrile, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-fluoro-4-(hydroxymethyl)-6-methoxybenzonitrile (CAS 2090953-73-2) is a chemical compound with the molecular formula C9H8FNO2 and a molecular weight of 181.16 g/mol. IUPAC name: 2-fluoro-4-(hydroxymethyl)-6-methoxybenzonitrile. InChIKey: YDHCKXFPFBKZKF-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO2 |
|---|---|
| Molecular weight | 181.16 g/mol |
| IUPAC name | 2-fluoro-4-(hydroxymethyl)-6-methoxybenzonitrile |
| InChIKey | YDHCKXFPFBKZKF-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)CO)F)C#N |
Computed by PubChem (NCBI)