Products 2091679-86-4
CAS 2091679-86-4 is the registry number for 1-Bromo-5-(bromomethyl)-4-chloro-2-fluorobenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-bromo-5-(bromomethyl)-4-chloro-2-fluorobenzene (CAS 2091679-86-4) is a chemical compound with the molecular formula C7H4Br2ClF and a molecular weight of 302.36 g/mol. IUPAC name: 1-bromo-5-(bromomethyl)-4-chloro-2-fluorobenzene. InChIKey: JIWPXBNWTTYGIG-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2ClF |
|---|---|
| Molecular weight | 302.36 g/mol |
| IUPAC name | 1-bromo-5-(bromomethyl)-4-chloro-2-fluorobenzene |
| InChIKey | JIWPXBNWTTYGIG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)F)Cl)CBr |
Computed by PubChem (NCBI)