CAS 20918-72-3 appears in our catalog under these names: 1-(1,1-Dimethylethyl) hydrogen N-[(phenylmethoxy)carbonyl]-D-glutamate, 98%, 98%, Cbz-D-Glu-OtBu, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 1g, 5g, 25g, 100g.
(4R)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid (CAS 20918-72-3) is a chemical compound with the molecular formula C17H23NO6 and a molecular weight of 337.4 g/mol. IUPAC name: (4R)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: VJECGKAFPHEJQS-CYBMUJFWSA-N.
| Molecular formula | C17H23NO6 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (4R)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | VJECGKAFPHEJQS-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H](CCC(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)