Products 20921-00-0
CAS 20921-00-0 appears in our catalog under these names: 6-Bromochroman-2-one 97%, 6-Bromochroman-2-one, 97%, 97%, 6-Bromochroman-2-one, 96%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 500mg, 2.5g, 10g.
6-bromo-3,4-dihydrochromen-2-one (CAS 20921-00-0) is a chemical compound with the molecular formula C9H7BrO2 and a molecular weight of 227.05 g/mol. IUPAC name: 6-bromo-3,4-dihydrochromen-2-one. InChIKey: FFZQWUVOIMYRKC-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO2 |
|---|---|
| Molecular weight | 227.05 g/mol |
| IUPAC name | 6-bromo-3,4-dihydrochromen-2-one |
| InChIKey | FFZQWUVOIMYRKC-UHFFFAOYSA-N |
| SMILES | C1CC(=O)OC2=C1C=C(C=C2)Br |
Computed by PubChem (NCBI)