Products 2092151-66-9
CAS 2092151-66-9 is the registry number for 3-Hydroxy-2-methyl-6-nitrobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-hydroxy-2-methyl-6-nitrobenzoic acid (CAS 2092151-66-9) is a chemical compound with the molecular formula C8H7NO5 and a molecular weight of 197.14 g/mol. IUPAC name: 3-hydroxy-2-methyl-6-nitrobenzoic acid. InChIKey: DYQDBUHBVFZAAU-UHFFFAOYSA-N.
| Molecular formula | C8H7NO5 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 3-hydroxy-2-methyl-6-nitrobenzoic acid |
| InChIKey | DYQDBUHBVFZAAU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C(=O)O)[N+](=O)[O-])O |
Computed by PubChem (NCBI)
Synonyms:
3-Hydroxy-2-methyl-6-nitrobenzoic acid