Products 2092438-66-7
CAS 2092438-66-7 is the registry number for 7-Bromo-1H,3H,4H-pyrrolo(2,1-c)(1,4)oxazine-1,3-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-bromo-4H-pyrrolo[2,1-c][1,4]oxazine-1,3-dione (CAS 2092438-66-7) is a chemical compound with the molecular formula C7H4BrNO3 and a molecular weight of 230.02 g/mol. IUPAC name: 7-bromo-4H-pyrrolo[2,1-c][1,4]oxazine-1,3-dione. InChIKey: KDIZECGVNORCGC-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO3 |
|---|---|
| Molecular weight | 230.02 g/mol |
| IUPAC name | 7-bromo-4H-pyrrolo[2,1-c][1,4]oxazine-1,3-dione |
| InChIKey | KDIZECGVNORCGC-UHFFFAOYSA-N |
| SMILES | C1C(=O)OC(=O)C2=CC(=CN21)Br |
Computed by PubChem (NCBI)