CAS 2092461-37-3 is the registry number for 4-Ethyl-7-nitro-1,2,3,4-tetrahydroquinoline. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-ethyl-7-nitro-1,2,3,4-tetrahydroquinoline (CAS 2092461-37-3) is a chemical compound with the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. IUPAC name: 4-ethyl-7-nitro-1,2,3,4-tetrahydroquinoline. InChIKey: QYVLPVAOMULIQK-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O2 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 4-ethyl-7-nitro-1,2,3,4-tetrahydroquinoline |
| InChIKey | QYVLPVAOMULIQK-UHFFFAOYSA-N |
| SMILES | CCC1CCNC2=C1C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)