CAS 209252-15-3 appears in our catalog under these names: (S)-N-Fmoc-3-Amino-3-phenylpropanoic acid, 95%, (S)–3–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–3–phenylpropanoic acid, (S)-3-((((9H-Fluoren-9-Yl)Methoxy)Carbonyl)Amino)-3-Phenylpropanoic Acid, 98%, 98%, Fmoc-D-β-Phe-OH, 95%. Offered by: Fluorochem, GLPBio, Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoic acid (CAS 209252-15-3) is a chemical compound with the molecular formula C24H21NO4 and a molecular weight of 387.4 g/mol. IUPAC name: (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoic acid. InChIKey: PTSLRPMRTOVHAB-QFIPXVFZSA-N.
| Molecular formula | C24H21NO4 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoic acid |
| InChIKey | PTSLRPMRTOVHAB-QFIPXVFZSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)