CAS 2092528-39-5 is the registry number for 5-Bromo-2-cyanobenzyl acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(5-bromo-2-cyanophenyl)methyl acetate (CAS 2092528-39-5) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: (5-bromo-2-cyanophenyl)methyl acetate. InChIKey: OFZSKJYIQMJKEL-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | (5-bromo-2-cyanophenyl)methyl acetate |
| InChIKey | OFZSKJYIQMJKEL-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1=C(C=CC(=C1)Br)C#N |
Computed by PubChem (NCBI)