Products 2092528-39-5

CAS 2092528-39-5 is the registry number for 5-Bromo-2-cyanobenzyl acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(5-bromo-2-cyanophenyl)methyl acetate (CAS 2092528-39-5) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: (5-bromo-2-cyanophenyl)methyl acetate. InChIKey: OFZSKJYIQMJKEL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8BrNO2
Molecular weight254.08 g/mol
IUPAC name(5-bromo-2-cyanophenyl)methyl acetate
InChIKeyOFZSKJYIQMJKEL-UHFFFAOYSA-N
SMILESCC(=O)OCC1=C(C=CC(=C1)Br)C#N

Computed by PubChem (NCBI)