CAS 2093287-60-4 is the registry number for Lorotomidate. Offered by: MedChemExpress. Available pack sizes: Get quote.
Ethyl 5-fluoro-3-[(1R)-1-phenylethyl]imidazole-4-carboxylate (CAS 2093287-60-4) is a chemical compound with the molecular formula C14H15FN2O2 and a molecular weight of 262.28 g/mol. IUPAC name: ethyl 5-fluoro-3-[(1R)-1-phenylethyl]imidazole-4-carboxylate. InChIKey: LLTPWRDHXHDIIG-SNVBAGLBSA-N.
| Molecular formula | C14H15FN2O2 |
|---|---|
| Molecular weight | 262.28 g/mol |
| IUPAC name | ethyl 5-fluoro-3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
| InChIKey | LLTPWRDHXHDIIG-SNVBAGLBSA-N |
| SMILES | CCOC(=O)C1=C(N=CN1[C@H](C)C2=CC=CC=C2)F |
Computed by PubChem (NCBI)