Products 2093503-71-8
CAS 2093503-71-8 is the registry number for DL-TBOA (ammonium). Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S,3S)-2-amino-3-phenylmethoxybutanedioic acid;azane (CAS 2093503-71-8) is a chemical compound with the molecular formula C11H16N2O5 and a molecular weight of 256.25 g/mol. IUPAC name: (2S,3S)-2-amino-3-phenylmethoxybutanedioic acid;azane. InChIKey: NWSNCKZFVJQJRK-OZZZDHQUSA-N.
| Molecular formula | C11H16N2O5 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | (2S,3S)-2-amino-3-phenylmethoxybutanedioic acid;azane |
| InChIKey | NWSNCKZFVJQJRK-OZZZDHQUSA-N |
| SMILES | C1=CC=C(C=C1)CO[C@@H]([C@@H](C(=O)O)N)C(=O)O.N |
Computed by PubChem (NCBI)