CAS 2094153-95-2 is the registry number for 2,3,4,5-Tetrahydro-1H-1-benzazepine-7-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,3,4,5-tetrahydro-1H-1-benzazepine-7-carboxylic acid;hydrochloride (CAS 2094153-95-2) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: 2,3,4,5-tetrahydro-1H-1-benzazepine-7-carboxylic acid;hydrochloride. InChIKey: TZRGHKWQFXLEMY-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 2,3,4,5-tetrahydro-1H-1-benzazepine-7-carboxylic acid;hydrochloride |
| InChIKey | TZRGHKWQFXLEMY-UHFFFAOYSA-N |
| SMILES | C1CCNC2=C(C1)C=C(C=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)