CAS 2095192-29-1 is the registry number for (3R,4R)-tert-Butyl 4-amino-3-ethylpiperidine-1-carboxylate hydrochloride, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3R,4R)-4-amino-3-ethylpiperidine-1-carboxylate;hydrochloride (CAS 2095192-29-1) is a chemical compound with the molecular formula C12H25ClN2O2 and a molecular weight of 264.79 g/mol. IUPAC name: tert-butyl (3R,4R)-4-amino-3-ethylpiperidine-1-carboxylate;hydrochloride. InChIKey: ATIIJTOXSTUYQS-DHTOPLTISA-N.
| Molecular formula | C12H25ClN2O2 |
|---|---|
| Molecular weight | 264.79 g/mol |
| IUPAC name | tert-butyl (3R,4R)-4-amino-3-ethylpiperidine-1-carboxylate;hydrochloride |
| InChIKey | ATIIJTOXSTUYQS-DHTOPLTISA-N |
| SMILES | CC[C@@H]1CN(CC[C@H]1N)C(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)