Products 2097136-42-8
CAS 2097136-42-8 appears in our catalog under these names: (S)–3'–hydroxy Blebbistatin, (3aS)-3a-Hydroxy-1-(3-hydroxyphenyl)-6-methyl-2,3-dihydropyrrolo(2,3-b)quinolin-4-one, (S)-3'-Hydroxy blebbistatin. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg, 5 mg, 10 mg, 1 mg.
(3aS)-3a-hydroxy-1-(3-hydroxyphenyl)-6-methyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-one (CAS 2097136-42-8) is a chemical compound with the molecular formula C18H16N2O3 and a molecular weight of 308.3 g/mol. IUPAC name: (3aS)-3a-hydroxy-1-(3-hydroxyphenyl)-6-methyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-one. InChIKey: OJXUBBKNTWQDFQ-GOSISDBHSA-N.
| Molecular formula | C18H16N2O3 |
|---|---|
| Molecular weight | 308.3 g/mol |
| IUPAC name | (3aS)-3a-hydroxy-1-(3-hydroxyphenyl)-6-methyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-one |
| InChIKey | OJXUBBKNTWQDFQ-GOSISDBHSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C3[C@](C2=O)(CCN3C4=CC(=CC=C4)O)O |
Computed by PubChem (NCBI)
Synonyms:
(S)-3'-hydroxy Blebbistatin, orb2283104