CAS 2097334-16-0 is the registry number for Netarsudil Impurity 1. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
2-[4-[(2,4-dimethylbenzoyl)oxymethyl]phenyl]acetic acid (CAS 2097334-16-0) is a chemical compound with the molecular formula C18H18O4 and a molecular weight of 298.3 g/mol. IUPAC name: 2-[4-[(2,4-dimethylbenzoyl)oxymethyl]phenyl]acetic acid. InChIKey: IMPGFLVLFXAEFS-UHFFFAOYSA-N.
| Molecular formula | C18H18O4 |
|---|---|
| Molecular weight | 298.3 g/mol |
| IUPAC name | 2-[4-[(2,4-dimethylbenzoyl)oxymethyl]phenyl]acetic acid |
| InChIKey | IMPGFLVLFXAEFS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)OCC2=CC=C(C=C2)CC(=O)O)C |
Computed by PubChem (NCBI)