Products 2098310-96-2
CAS 2098310-96-2 is the registry number for 8-Methoxy-3-((1E)-3-(2-methoxyphenyl)-3-oxo-1-propen-1-yl)-2(1H)-quinolinone. Offered by: TRC. Available pack sizes: 100mg.
8-methoxy-3-[(E)-3-(2-methoxyphenyl)-3-oxoprop-1-enyl]-1H-quinolin-2-one (CAS 2098310-96-2) is a chemical compound with the molecular formula C20H17NO4 and a molecular weight of 335.4 g/mol. IUPAC name: 8-methoxy-3-[(E)-3-(2-methoxyphenyl)-3-oxoprop-1-enyl]-1H-quinolin-2-one. InChIKey: KMTXOHJJHMCMLQ-ZHACJKMWSA-N.
| Molecular formula | C20H17NO4 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 8-methoxy-3-[(E)-3-(2-methoxyphenyl)-3-oxoprop-1-enyl]-1H-quinolin-2-one |
| InChIKey | KMTXOHJJHMCMLQ-ZHACJKMWSA-N |
| SMILES | COC1=CC=CC=C1C(=O)/C=C/C2=CC3=C(C(=CC=C3)OC)NC2=O |
Computed by PubChem (NCBI)