Products 2098857-13-5
CAS 2098857-13-5 is the registry number for 2-tert-butyl-5-ethoxycarbonyl-pyrazole-3-carboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1-tert-butyl-3-ethoxycarbonylpyrazole-5-carboxylic acid (CAS 2098857-13-5) is a chemical compound with the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. IUPAC name: 1-tert-butyl-3-ethoxycarbonylpyrazole-5-carboxylic acid. InChIKey: OYYRNSZWVOAHMB-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O4 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 1-tert-butyl-3-ethoxycarbonylpyrazole-5-carboxylic acid |
| InChIKey | OYYRNSZWVOAHMB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN(C(=C1)C(=O)O)C(C)(C)C |
Computed by PubChem (NCBI)